C24H18FNO — CID 14303719
2-(4-fluorophenyl)-3-methyl-1,6-diphenylpyridin-4-one (PubChem CID 14303719) has the molecular formula C24H18FNO and a molecular weight of 355.41 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-methyl-1,6-diphenylpyridin-4-one.
| Compound Name | 2-(4-fluorophenyl)-3-methyl-1,6-diphenylpyridin-4-one |
|---|---|
| PubChem CID | 14303719 |
| Molecular Formula | C24H18FNO |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-(4-fluorophenyl)-3-methyl-1,6-diphenylpyridin-4-one |
| SMILES | Cc1c(-c2ccc(F)cc2)n(-c2ccccc2)c(-c2ccccc2)cc1=O |
| InChI | InChI=1S/C24H18FNO/c1-17-23(27)16-22(18-8-4-2-5-9-18)26(21-10-6-3-7-11-21)24(17)19-12-14-20(25)15-13-19/h2-16H,1H3 |
| InChIKey | MCNRZKMZMBVUSR-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |