C24H17Cl2NO — CID 14303623
1-(2,4-dichlorophenyl)-3-methyl-2,6-diphenylpyridin-4-one (PubChem CID 14303623) has the molecular formula C24H17Cl2NO and a molecular weight of 406.31 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-methyl-2,6-diphenylpyridin-4-one.
| Compound Name | 1-(2,4-dichlorophenyl)-3-methyl-2,6-diphenylpyridin-4-one |
|---|---|
| PubChem CID | 14303623 |
| Molecular Formula | C24H17Cl2NO |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-methyl-2,6-diphenylpyridin-4-one |
| SMILES | Cc1c(-c2ccccc2)n(-c2ccc(Cl)cc2Cl)c(-c2ccccc2)cc1=O |
| InChI | InChI=1S/C24H17Cl2NO/c1-16-23(28)15-22(17-8-4-2-5-9-17)27(21-13-12-19(25)14-20(21)26)24(16)18-10-6-3-7-11-18/h2-15H,1H3 |
| InChIKey | PGRFVPIBIMFZFP-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |