C21H21NO — CID 14517569
3-methyl-2,6-diphenyl-1-propylpyridin-4-one (PubChem CID 14517569) has the molecular formula C21H21NO and a molecular weight of 303.41 g/mol. Its IUPAC name is 3-methyl-2,6-diphenyl-1-propylpyridin-4-one.
| Compound Name | 3-methyl-2,6-diphenyl-1-propylpyridin-4-one |
|---|---|
| PubChem CID | 14517569 |
| Molecular Formula | C21H21NO |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 3-methyl-2,6-diphenyl-1-propylpyridin-4-one |
| SMILES | CCCn1c(-c2ccccc2)cc(=O)c(C)c1-c1ccccc1 |
| InChI | InChI=1S/C21H21NO/c1-3-14-22-19(17-10-6-4-7-11-17)15-20(23)16(2)21(22)18-12-8-5-9-13-18/h4-13,15H,3,14H2,1-2H3 |
| InChIKey | YMLYRWXNDCHZDT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |