C25H29NO — CID 14621388
6-heptyl-3-methyl-1,2-diphenylpyridin-4-one (PubChem CID 14621388) has the molecular formula C25H29NO and a molecular weight of 359.51 g/mol. Its IUPAC name is 6-heptyl-3-methyl-1,2-diphenylpyridin-4-one.
| Compound Name | 6-heptyl-3-methyl-1,2-diphenylpyridin-4-one |
|---|---|
| PubChem CID | 14621388 |
| Molecular Formula | C25H29NO |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 6-heptyl-3-methyl-1,2-diphenylpyridin-4-one |
| SMILES | CCCCCCCc1cc(=O)c(C)c(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C25H29NO/c1-3-4-5-6-11-18-23-19-24(27)20(2)25(21-14-9-7-10-15-21)26(23)22-16-12-8-13-17-22/h7-10,12-17,19H,3-6,11,18H2,1-2H3 |
| InChIKey | YNAXMJMEUMFPST-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|