C16H23N3O — CID 101266229
3-octyl-4-phenyl-1H-1,2,4-triazol-5-one (PubChem CID 101266229) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 3-octyl-4-phenyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-octyl-4-phenyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 101266229 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 3-octyl-4-phenyl-1H-1,2,4-triazol-5-one |
| SMILES | CCCCCCCCc1n[nH]c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C16H23N3O/c1-2-3-4-5-6-10-13-15-17-18-16(20)19(15)14-11-8-7-9-12-14/h7-9,11-12H,2-6,10,13H2,1H3,(H,18,20) |
| InChIKey | QMPNPORBRZCQEI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|