C11H22N4O — CID 102655236
3-(5-aminopentyl)-4-butyl-1H-1,2,4-triazol-5-one (PubChem CID 102655236) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-(5-aminopentyl)-4-butyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(5-aminopentyl)-4-butyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 102655236 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 3-(5-aminopentyl)-4-butyl-1H-1,2,4-triazol-5-one |
| SMILES | CCCCn1c(CCCCCN)n[nH]c1=O |
| InChI | InChI=1S/C11H22N4O/c1-2-3-9-15-10(13-14-11(15)16)7-5-4-6-8-12/h2-9,12H2,1H3,(H,14,16) |
| InChIKey | JGHSRBJCZAMJEF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|