C19H22N4OS — CID 135778960
3-hexyl-5-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1H-pyridin-4-one (PubChem CID 135778960) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is 3-hexyl-5-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1H-pyridin-4-one.
| Compound Name | 3-hexyl-5-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 135778960 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 3-hexyl-5-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1H-pyridin-4-one |
| SMILES | CCCCCCc1c[nH]cc(-c2n[nH]c(=S)n2-c2ccccc2)c1=O |
| InChI | InChI=1S/C19H22N4OS/c1-2-3-4-6-9-14-12-20-13-16(17(14)24)18-21-22-19(25)23(18)15-10-7-5-8-11-15/h5,7-8,10-13H,2-4,6,9H2,1H3,(H,20,24)(H,22,25) |
| InChIKey | KNSKVMAJPNKTDI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 66.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|