About 3,4-dihexyl-1H-pyrrole
3,4-dihexyl-1H-pyrrole (PubChem CID 67204335) has the molecular formula C16H29N
and a molecular weight of 235.41 g/mol. Its IUPAC name is 3,4-dihexyl-1H-pyrrole.
Molecular Properties
| Compound Name | 3,4-dihexyl-1H-pyrrole |
| PubChem CID | 67204335 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 3,4-dihexyl-1H-pyrrole |
| SMILES | CCCCCCc1c[nH]cc1CCCCCC |
| InChI | InChI=1S/C16H29N/c1-3-5-7-9-11-15-13-17-14-16(15)12-10-8-6-4-2/h13-14,17H,3-12H2,1-2H3 |
| InChIKey | NZCKWPBBYINXJT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihexyl-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihexyl-1H-pyrrole?
The IUPAC name of 3,4-dihexyl-1H-pyrrole (CID 67204335) is 3,4-dihexyl-1H-pyrrole.
What is the SMILES notation for 3,4-dihexyl-1H-pyrrole?
The canonical SMILES for 3,4-dihexyl-1H-pyrrole is CCCCCCc1c[nH]cc1CCCCCC.
What is the InChIKey of 3,4-dihexyl-1H-pyrrole?
The InChIKey is NZCKWPBBYINXJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N/c1-3-5-7-9-11-15-13-17-14-16(15)12-10-8-6-4-2/h13-14,17H,3-12H2,1-2H3.
What are the key properties of 3,4-dihexyl-1H-pyrrole?
3,4-dihexyl-1H-pyrrole has a molecular weight of 235.41 g/mol, XLogP of 5.26, 10 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihexyl-1H-pyrrole is sourced from PubChem (CID 67204335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).