C13H16N4OS — CID 139238180
4-phenyl-3-(thiomorpholin-4-ylmethyl)-1H-1,2,4-triazol-5-one (PubChem CID 139238180) has the molecular formula C13H16N4OS and a molecular weight of 276.36 g/mol. Its IUPAC name is 4-phenyl-3-(thiomorpholin-4-ylmethyl)-1H-1,2,4-triazol-5-one.
| Compound Name | 4-phenyl-3-(thiomorpholin-4-ylmethyl)-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 139238180 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 4-phenyl-3-(thiomorpholin-4-ylmethyl)-1H-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(CN2CCSCC2)n1-c1ccccc1 |
| InChI | InChI=1S/C13H16N4OS/c18-13-15-14-12(10-16-6-8-19-9-7-16)17(13)11-4-2-1-3-5-11/h1-5H,6-10H2,(H,15,18) |
| InChIKey | FHIWTDSMUXJGJQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |