C28H32N2O4P+ — CID 70278239
dihydroxy(oxo)phosphanium;1-heptyl-3,4,5-triphenylimidazol-2-one (PubChem CID 70278239) has the molecular formula C28H32N2O4P+ and a molecular weight of 491.55 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;1-heptyl-3,4,5-triphenylimidazol-2-one.
| Compound Name | dihydroxy(oxo)phosphanium;1-heptyl-3,4,5-triphenylimidazol-2-one |
|---|---|
| PubChem CID | 70278239 |
| Molecular Formula | C28H32N2O4P+ |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | dihydroxy(oxo)phosphanium;1-heptyl-3,4,5-triphenylimidazol-2-one |
| SMILES | CCCCCCCn1c(-c2ccccc2)c(-c2ccccc2)n(-c2ccccc2)c1=O.O=[P+](O)O |
| InChI | InChI=1S/C28H30N2O.HO3P/c1-2-3-4-5-15-22-29-26(23-16-9-6-10-17-23)27(24-18-11-7-12-19-24)30(28(29)31)25-20-13-8-14-21-25;1-4(2)3/h6-14,16-21H,2-5,15,22H2,1H3;(H-,1,2,3)/p+1 |
| InChIKey | PWUYKKDYKJHFRP-UHFFFAOYSA-O |
| XLogP | 6.57 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|