C30H40N2O2 — CID 142656477
5,6-dibenzyl-1,3-dihexylpyrimidine-2,4-dione (PubChem CID 142656477) has the molecular formula C30H40N2O2 and a molecular weight of 460.66 g/mol. Its IUPAC name is 5,6-dibenzyl-1,3-dihexylpyrimidine-2,4-dione.
| Compound Name | 5,6-dibenzyl-1,3-dihexylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142656477 |
| Molecular Formula | C30H40N2O2 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | 5,6-dibenzyl-1,3-dihexylpyrimidine-2,4-dione |
| SMILES | CCCCCCn1c(Cc2ccccc2)c(Cc2ccccc2)c(=O)n(CCCCCC)c1=O |
| InChI | InChI=1S/C30H40N2O2/c1-3-5-7-15-21-31-28(24-26-19-13-10-14-20-26)27(23-25-17-11-9-12-18-25)29(33)32(30(31)34)22-16-8-6-4-2/h9-14,17-20H,3-8,15-16,21-24H2,1-2H3 |
| InChIKey | AJDAIRCUURRWFW-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|