C28H31N2NaO — CID 173291482
sodium;1-heptyl-3,4,5-triphenylimidazol-2-one;hydride (PubChem CID 173291482) has the molecular formula C28H31N2NaO and a molecular weight of 434.56 g/mol. Its IUPAC name is sodium;1-heptyl-3,4,5-triphenylimidazol-2-one;hydride.
| Compound Name | sodium;1-heptyl-3,4,5-triphenylimidazol-2-one;hydride |
|---|---|
| PubChem CID | 173291482 |
| Molecular Formula | C28H31N2NaO |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | sodium;1-heptyl-3,4,5-triphenylimidazol-2-one;hydride |
| SMILES | CCCCCCCn1c(-c2ccccc2)c(-c2ccccc2)n(-c2ccccc2)c1=O.[H-].[Na+] |
| InChI | InChI=1S/C28H30N2O.Na.H/c1-2-3-4-5-15-22-29-26(23-16-9-6-10-17-23)27(24-18-11-7-12-19-24)30(28(29)31)25-20-13-8-14-21-25;;/h6-14,16-21H,2-5,15,22H2,1H3;;/q;+1;-1 |
| InChIKey | LAKICERCGXULSO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|