C24H24N2O2 — CID 137158258
5-hexyl-6-hydroxy-1,4-diphenylpyrrolo[3,4-c]pyrrol-3-one (PubChem CID 137158258) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 5-hexyl-6-hydroxy-1,4-diphenylpyrrolo[3,4-c]pyrrol-3-one.
| Compound Name | 5-hexyl-6-hydroxy-1,4-diphenylpyrrolo[3,4-c]pyrrol-3-one |
|---|---|
| PubChem CID | 137158258 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 5-hexyl-6-hydroxy-1,4-diphenylpyrrolo[3,4-c]pyrrol-3-one |
| SMILES | CCCCCCn1c(O)c2c(c1-c1ccccc1)C(=O)N=C2c1ccccc1 |
| InChI | InChI=1S/C24H24N2O2/c1-2-3-4-11-16-26-22(18-14-9-6-10-15-18)20-19(24(26)28)21(25-23(20)27)17-12-7-5-8-13-17/h5-10,12-15,28H,2-4,11,16H2,1H3 |
| InChIKey | DBNVNDFHCJSCAY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|