About 5-hexyl-6-hydroxy-1,4-diphenylpyrrolo[3,4-c]pyrrol-3-one
5-hexyl-6-hydroxy-1,4-diphenylpyrrolo[3,4-c]pyrrol-3-one (PubChem CID 137158258) has the molecular formula C24H24N2O2
and a molecular weight of 372.47 g/mol. Its IUPAC name is 5-hexyl-6-hydroxy-1,4-diphenylpyrrolo[3,4-c]pyrrol-3-one.
Molecular Properties
| Compound Name | 5-hexyl-6-hydroxy-1,4-diphenylpyrrolo[3,4-c]pyrrol-3-one |
| PubChem CID | 137158258 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 5-hexyl-6-hydroxy-1,4-diphenylpyrrolo[3,4-c]pyrrol-3-one |
| SMILES | CCCCCCn1c(O)c2c(c1-c1ccccc1)C(=O)N=C2c1ccccc1 |
| InChI | InChI=1S/C24H24N2O2/c1-2-3-4-11-16-26-22(18-14-9-6-10-15-18)20-19(24(26)28)21(25-23(20)27)17-12-7-5-8-13-17/h5-10,12-15,28H,2-4,11,16H2,1H3 |
| InChIKey | DBNVNDFHCJSCAY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hexyl-6-hydroxy-1,4-diphenylpyrrolo[3,4-c]pyrrol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexyl-6-hydroxy-1,4-diphenylpyrrolo[3,4-c]pyrrol-3-one?
The IUPAC name of 5-hexyl-6-hydroxy-1,4-diphenylpyrrolo[3,4-c]pyrrol-3-one (CID 137158258) is 5-hexyl-6-hydroxy-1,4-diphenylpyrrolo[3,4-c]pyrrol-3-one.
What is the SMILES notation for 5-hexyl-6-hydroxy-1,4-diphenylpyrrolo[3,4-c]pyrrol-3-one?
The canonical SMILES for 5-hexyl-6-hydroxy-1,4-diphenylpyrrolo[3,4-c]pyrrol-3-one is CCCCCCn1c(O)c2c(c1-c1ccccc1)C(=O)N=C2c1ccccc1.
What is the InChIKey of 5-hexyl-6-hydroxy-1,4-diphenylpyrrolo[3,4-c]pyrrol-3-one?
The InChIKey is DBNVNDFHCJSCAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N2O2/c1-2-3-4-11-16-26-22(18-14-9-6-10-15-18)20-19(24(26)28)21(25-23(20)27)17-12-7-5-8-13-17/h5-10,12-15,28H,2-4,11,16H2,1H3.
What are the key properties of 5-hexyl-6-hydroxy-1,4-diphenylpyrrolo[3,4-c]pyrrol-3-one?
5-hexyl-6-hydroxy-1,4-diphenylpyrrolo[3,4-c]pyrrol-3-one has a molecular weight of 372.47 g/mol, XLogP of 5.43, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexyl-6-hydroxy-1,4-diphenylpyrrolo[3,4-c]pyrrol-3-one is sourced from PubChem (CID 137158258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).