C25H25N3O3 — CID 135822357
1-hexyl-6-hydroxy-5-[(E)-(2-phenylindol-3-ylidene)methyl]pyrimidine-2,4-dione (PubChem CID 135822357) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 1-hexyl-6-hydroxy-5-[(E)-(2-phenylindol-3-ylidene)methyl]pyrimidine-2,4-dione.
| Compound Name | 1-hexyl-6-hydroxy-5-[(E)-(2-phenylindol-3-ylidene)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135822357 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 1-hexyl-6-hydroxy-5-[(E)-(2-phenylindol-3-ylidene)methyl]pyrimidine-2,4-dione |
| SMILES | CCCCCCn1c(O)c(/C=C2/C(c3ccccc3)=Nc3ccccc32)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H25N3O3/c1-2-3-4-10-15-28-24(30)20(23(29)27-25(28)31)16-19-18-13-8-9-14-21(18)26-22(19)17-11-6-5-7-12-17/h5-9,11-14,16,30H,2-4,10,15H2,1H3,(H,27,29,31)/b19-16+ |
| InChIKey | SXYYJJGEKVVOJU-KNTRCKAVSA-N |
| XLogP | 4.50 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|