C27H21N3O2S — CID 2034701
1-(3,4-dimethylphenyl)-6-hydroxy-5-[(2-phenylindol-3-ylidene)methyl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 2034701) has the molecular formula C27H21N3O2S and a molecular weight of 451.55 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-6-hydroxy-5-[(2-phenylindol-3-ylidene)methyl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-(3,4-dimethylphenyl)-6-hydroxy-5-[(2-phenylindol-3-ylidene)methyl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 2034701 |
| Molecular Formula | C27H21N3O2S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-6-hydroxy-5-[(2-phenylindol-3-ylidene)methyl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | Cc1ccc(-n2c(O)c(C=C3C(c4ccccc4)=Nc4ccccc43)c(=O)[nH]c2=S)cc1C |
| InChI | InChI=1S/C27H21N3O2S/c1-16-12-13-19(14-17(16)2)30-26(32)22(25(31)29-27(30)33)15-21-20-10-6-7-11-23(20)28-24(21)18-8-4-3-5-9-18/h3-15,32H,1-2H3,(H,29,31,33) |
| InChIKey | CKBVNXFUGZIBEN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|