C23H21N3O2S — CID 3313719
1-butyl-6-hydroxy-5-[(2-phenylindol-3-ylidene)methyl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 3313719) has the molecular formula C23H21N3O2S and a molecular weight of 403.51 g/mol. Its IUPAC name is 1-butyl-6-hydroxy-5-[(2-phenylindol-3-ylidene)methyl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-butyl-6-hydroxy-5-[(2-phenylindol-3-ylidene)methyl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 3313719 |
| Molecular Formula | C23H21N3O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 1-butyl-6-hydroxy-5-[(2-phenylindol-3-ylidene)methyl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | CCCCn1c(O)c(C=C2C(c3ccccc3)=Nc3ccccc32)c(=O)[nH]c1=S |
| InChI | InChI=1S/C23H21N3O2S/c1-2-3-13-26-22(28)18(21(27)25-23(26)29)14-17-16-11-7-8-12-19(16)24-20(17)15-9-5-4-6-10-15/h4-12,14,28H,2-3,13H2,1H3,(H,25,27,29) |
| InChIKey | ILEVZPLBFUYYRB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|