C21H16N2OS2 — CID 3108427
4-hydroxy-5-[(2-phenylindol-3-ylidene)methyl]-3-prop-2-enyl-1,3-thiazole-2-thione (PubChem CID 3108427) has the molecular formula C21H16N2OS2 and a molecular weight of 376.51 g/mol. Its IUPAC name is 4-hydroxy-5-[(2-phenylindol-3-ylidene)methyl]-3-prop-2-enyl-1,3-thiazole-2-thione.
| Compound Name | 4-hydroxy-5-[(2-phenylindol-3-ylidene)methyl]-3-prop-2-enyl-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 3108427 |
| Molecular Formula | C21H16N2OS2 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 4-hydroxy-5-[(2-phenylindol-3-ylidene)methyl]-3-prop-2-enyl-1,3-thiazole-2-thione |
| SMILES | C=CCn1c(O)c(C=C2C(c3ccccc3)=Nc3ccccc32)sc1=S |
| InChI | InChI=1S/C21H16N2OS2/c1-2-12-23-20(24)18(26-21(23)25)13-16-15-10-6-7-11-17(15)22-19(16)14-8-4-3-5-9-14/h2-11,13,24H,1,12H2 |
| InChIKey | HINPNMYIWOKZBA-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|