C20H15N3OS2 — CID 135490133
3-benzyl-4-hydroxy-5-[(E)-(3-phenylpyrazol-4-ylidene)methyl]-1,3-thiazole-2-thione (PubChem CID 135490133) has the molecular formula C20H15N3OS2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 3-benzyl-4-hydroxy-5-[(E)-(3-phenylpyrazol-4-ylidene)methyl]-1,3-thiazole-2-thione.
| Compound Name | 3-benzyl-4-hydroxy-5-[(E)-(3-phenylpyrazol-4-ylidene)methyl]-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 135490133 |
| Molecular Formula | C20H15N3OS2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 3-benzyl-4-hydroxy-5-[(E)-(3-phenylpyrazol-4-ylidene)methyl]-1,3-thiazole-2-thione |
| SMILES | Oc1c(/C=C2\C=NN=C2c2ccccc2)sc(=S)n1Cc1ccccc1 |
| InChI | InChI=1S/C20H15N3OS2/c24-19-17(26-20(25)23(19)13-14-7-3-1-4-8-14)11-16-12-21-22-18(16)15-9-5-2-6-10-15/h1-12,24H,13H2/b16-11+ |
| InChIKey | VYJYJSPOTSDUKY-LFIBNONCSA-N |
| XLogP | 4.91 |
| TPSA | 49.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|