C20H14N4O3S2 — CID 135782398
3-benzyl-5-[(Z)-[3-(3-nitrophenyl)pyrazol-4-ylidene]methyl]-4-sulfanyl-1,3-thiazol-2-one (PubChem CID 135782398) has the molecular formula C20H14N4O3S2 and a molecular weight of 422.49 g/mol. Its IUPAC name is 3-benzyl-5-[(Z)-[3-(3-nitrophenyl)pyrazol-4-ylidene]methyl]-4-sulfanyl-1,3-thiazol-2-one.
| Compound Name | 3-benzyl-5-[(Z)-[3-(3-nitrophenyl)pyrazol-4-ylidene]methyl]-4-sulfanyl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 135782398 |
| Molecular Formula | C20H14N4O3S2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 3-benzyl-5-[(Z)-[3-(3-nitrophenyl)pyrazol-4-ylidene]methyl]-4-sulfanyl-1,3-thiazol-2-one |
| SMILES | O=c1sc(/C=C2/C=NN=C2c2cccc([N+](=O)[O-])c2)c(S)n1Cc1ccccc1 |
| InChI | InChI=1S/C20H14N4O3S2/c25-20-23(12-13-5-2-1-3-6-13)19(28)17(29-20)10-15-11-21-22-18(15)14-7-4-8-16(9-14)24(26)27/h1-11,28H,12H2/b15-10- |
| InChIKey | LJYCCBBFXNGKSG-GDNBJRDFSA-N |
| XLogP | 4.03 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|