C17H12N4O7S2 — CID 135413175
2-[4-hydroxy-5-[[3-(3-nitrophenyl)pyrazol-4-ylidene]methyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanedioic acid (PubChem CID 135413175) has the molecular formula C17H12N4O7S2 and a molecular weight of 448.44 g/mol. Its IUPAC name is 2-[4-hydroxy-5-[[3-(3-nitrophenyl)pyrazol-4-ylidene]methyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanedioic acid.
| Compound Name | 2-[4-hydroxy-5-[[3-(3-nitrophenyl)pyrazol-4-ylidene]methyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanedioic acid |
|---|---|
| PubChem CID | 135413175 |
| Molecular Formula | C17H12N4O7S2 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | 2-[4-hydroxy-5-[[3-(3-nitrophenyl)pyrazol-4-ylidene]methyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)n1c(O)c(C=C2C=NN=C2c2cccc([N+](=O)[O-])c2)sc1=S |
| InChI | InChI=1S/C17H12N4O7S2/c22-13(23)6-11(16(25)26)20-15(24)12(30-17(20)29)5-9-7-18-19-14(9)8-2-1-3-10(4-8)21(27)28/h1-5,7,11,24H,6H2,(H,22,23)(H,25,26) |
| InChIKey | ADQFFUHHSBWOGC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 167.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|