C20H14N4O4S — CID 135782676
4-hydroxy-3-(2-methylphenyl)-5-[(Z)-[3-(3-nitrophenyl)pyrazol-4-ylidene]methyl]-1,3-thiazol-2-one (PubChem CID 135782676) has the molecular formula C20H14N4O4S and a molecular weight of 406.42 g/mol. Its IUPAC name is 4-hydroxy-3-(2-methylphenyl)-5-[(Z)-[3-(3-nitrophenyl)pyrazol-4-ylidene]methyl]-1,3-thiazol-2-one.
| Compound Name | 4-hydroxy-3-(2-methylphenyl)-5-[(Z)-[3-(3-nitrophenyl)pyrazol-4-ylidene]methyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 135782676 |
| Molecular Formula | C20H14N4O4S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 4-hydroxy-3-(2-methylphenyl)-5-[(Z)-[3-(3-nitrophenyl)pyrazol-4-ylidene]methyl]-1,3-thiazol-2-one |
| SMILES | Cc1ccccc1-n1c(O)c(/C=C2/C=NN=C2c2cccc([N+](=O)[O-])c2)sc1=O |
| InChI | InChI=1S/C20H14N4O4S/c1-12-5-2-3-8-16(12)23-19(25)17(29-20(23)26)10-14-11-21-22-18(14)13-6-4-7-15(9-13)24(27)28/h2-11,25H,1H3/b14-10- |
| InChIKey | NWTMGQKMLMJASW-UVTDQMKNSA-N |
| XLogP | 3.69 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|