C22H18N6O4 — CID 3672259
2,4-dimethyl-6-(2-methylphenyl)-7-(3-nitrophenyl)purino[7,8-a]imidazole-1,3-dione (PubChem CID 3672259) has the molecular formula C22H18N6O4 and a molecular weight of 430.42 g/mol. Its IUPAC name is 2,4-dimethyl-6-(2-methylphenyl)-7-(3-nitrophenyl)purino[7,8-a]imidazole-1,3-dione.
| Compound Name | 2,4-dimethyl-6-(2-methylphenyl)-7-(3-nitrophenyl)purino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 3672259 |
| Molecular Formula | C22H18N6O4 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 2,4-dimethyl-6-(2-methylphenyl)-7-(3-nitrophenyl)purino[7,8-a]imidazole-1,3-dione |
| SMILES | Cc1ccccc1-n1c(-c2cccc([N+](=O)[O-])c2)cn2c3c(=O)n(C)c(=O)n(C)c3nc12 |
| InChI | InChI=1S/C22H18N6O4/c1-13-7-4-5-10-16(13)27-17(14-8-6-9-15(11-14)28(31)32)12-26-18-19(23-21(26)27)24(2)22(30)25(3)20(18)29/h4-12H,1-3H3 |
| InChIKey | FUFOGQOCIOAGTO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|