C23H20N6O5 — CID 3438364
6-(4-ethoxyphenyl)-2,4-dimethyl-7-(3-nitrophenyl)purino[7,8-a]imidazole-1,3-dione (PubChem CID 3438364) has the molecular formula C23H20N6O5 and a molecular weight of 460.45 g/mol. Its IUPAC name is 6-(4-ethoxyphenyl)-2,4-dimethyl-7-(3-nitrophenyl)purino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-(4-ethoxyphenyl)-2,4-dimethyl-7-(3-nitrophenyl)purino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 3438364 |
| Molecular Formula | C23H20N6O5 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 6-(4-ethoxyphenyl)-2,4-dimethyl-7-(3-nitrophenyl)purino[7,8-a]imidazole-1,3-dione |
| SMILES | CCOc1ccc(-n2c(-c3cccc([N+](=O)[O-])c3)cn3c4c(=O)n(C)c(=O)n(C)c4nc23)cc1 |
| InChI | InChI=1S/C23H20N6O5/c1-4-34-17-10-8-15(9-11-17)28-18(14-6-5-7-16(12-14)29(32)33)13-27-19-20(24-22(27)28)25(2)23(31)26(3)21(19)30/h5-13H,4H2,1-3H3 |
| InChIKey | QPTOHXLYGIZSGC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 118.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|