C30H35N5O3 — CID 16762588
6-(4-ethoxyphenyl)-7-(4-heptylphenyl)-2,4-dimethylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 16762588) has the molecular formula C30H35N5O3 and a molecular weight of 513.64 g/mol. Its IUPAC name is 6-(4-ethoxyphenyl)-7-(4-heptylphenyl)-2,4-dimethylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-(4-ethoxyphenyl)-7-(4-heptylphenyl)-2,4-dimethylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 16762588 |
| Molecular Formula | C30H35N5O3 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | 6-(4-ethoxyphenyl)-7-(4-heptylphenyl)-2,4-dimethylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | CCCCCCCc1ccc(-c2cn3c4c(=O)n(C)c(=O)n(C)c4nc3n2-c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C30H35N5O3/c1-5-7-8-9-10-11-21-12-14-22(15-13-21)25-20-34-26-27(32(3)30(37)33(4)28(26)36)31-29(34)35(25)23-16-18-24(19-17-23)38-6-2/h12-20H,5-11H2,1-4H3 |
| InChIKey | QSOBKQTYAAWKHO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 75.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|