C29H33N5O3 — CID 3768877
2,4-dimethyl-6-(4-octoxyphenyl)-7-phenylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 3768877) has the molecular formula C29H33N5O3 and a molecular weight of 499.62 g/mol. Its IUPAC name is 2,4-dimethyl-6-(4-octoxyphenyl)-7-phenylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 2,4-dimethyl-6-(4-octoxyphenyl)-7-phenylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 3768877 |
| Molecular Formula | C29H33N5O3 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | 2,4-dimethyl-6-(4-octoxyphenyl)-7-phenylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | CCCCCCCCOc1ccc(-n2c(-c3ccccc3)cn3c4c(=O)n(C)c(=O)n(C)c4nc23)cc1 |
| InChI | InChI=1S/C29H33N5O3/c1-4-5-6-7-8-12-19-37-23-17-15-22(16-18-23)34-24(21-13-10-9-11-14-21)20-33-25-26(30-28(33)34)31(2)29(36)32(3)27(25)35/h9-11,13-18,20H,4-8,12,19H2,1-3H3 |
| InChIKey | DSMZFSXQSVEPID-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 75.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|