C23H21N7O4 — CID 3730617
6-[4-(dimethylamino)phenyl]-2,4-dimethyl-7-(3-nitrophenyl)purino[7,8-a]imidazole-1,3-dione (PubChem CID 3730617) has the molecular formula C23H21N7O4 and a molecular weight of 459.47 g/mol. Its IUPAC name is 6-[4-(dimethylamino)phenyl]-2,4-dimethyl-7-(3-nitrophenyl)purino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-[4-(dimethylamino)phenyl]-2,4-dimethyl-7-(3-nitrophenyl)purino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 3730617 |
| Molecular Formula | C23H21N7O4 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 6-[4-(dimethylamino)phenyl]-2,4-dimethyl-7-(3-nitrophenyl)purino[7,8-a]imidazole-1,3-dione |
| SMILES | CN(C)c1ccc(-n2c(-c3cccc([N+](=O)[O-])c3)cn3c4c(=O)n(C)c(=O)n(C)c4nc23)cc1 |
| InChI | InChI=1S/C23H21N7O4/c1-25(2)15-8-10-16(11-9-15)29-18(14-6-5-7-17(12-14)30(33)34)13-28-19-20(24-22(28)29)26(3)23(32)27(4)21(19)31/h5-13H,1-4H3 |
| InChIKey | HVPOTCZKOHEHPC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 112.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|