C16H12N3O3S2- — CID 135745665
3-[4-hydroxy-5-[(E)-(3-phenylpyrazol-4-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]propanoate (PubChem CID 135745665) has the molecular formula C16H12N3O3S2- and a molecular weight of 358.42 g/mol. Its IUPAC name is 3-[4-hydroxy-5-[(E)-(3-phenylpyrazol-4-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]propanoate.
| Compound Name | 3-[4-hydroxy-5-[(E)-(3-phenylpyrazol-4-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]propanoate |
|---|---|
| PubChem CID | 135745665 |
| Molecular Formula | C16H12N3O3S2- |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 3-[4-hydroxy-5-[(E)-(3-phenylpyrazol-4-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]propanoate |
| SMILES | O=C([O-])CCn1c(O)c(/C=C2\C=NN=C2c2ccccc2)sc1=S |
| InChI | InChI=1S/C16H13N3O3S2/c20-13(21)6-7-19-15(22)12(24-16(19)23)8-11-9-17-18-14(11)10-4-2-1-3-5-10/h1-5,8-9,22H,6-7H2,(H,20,21)/p-1/b11-8+ |
| InChIKey | ZPCPRBNKBOLRGX-DHZHZOJOSA-M |
| XLogP | 2.00 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|