C19H12N4O4S2 — CID 135421016
N-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]-3-nitrobenzamide (PubChem CID 135421016) has the molecular formula C19H12N4O4S2 and a molecular weight of 424.46 g/mol. Its IUPAC name is N-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]-3-nitrobenzamide.
| Compound Name | N-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 135421016 |
| Molecular Formula | C19H12N4O4S2 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | N-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]-3-nitrobenzamide |
| SMILES | O=C(Nn1c(O)c(/C=C2\C=Nc3ccccc32)sc1=S)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H12N4O4S2/c24-17(11-4-3-5-13(8-11)23(26)27)21-22-18(25)16(29-19(22)28)9-12-10-20-15-7-2-1-6-14(12)15/h1-10,25H,(H,21,24)/b12-9+ |
| InChIKey | ZTEAYWOKOOVVDK-FMIVXFBMSA-N |
| XLogP | 4.53 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|