C22H18N4O4S2 — CID 135718225
4-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]-N-(4-nitrophenyl)butanamide (PubChem CID 135718225) has the molecular formula C22H18N4O4S2 and a molecular weight of 466.54 g/mol. Its IUPAC name is 4-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]-N-(4-nitrophenyl)butanamide.
| Compound Name | 4-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]-N-(4-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 135718225 |
| Molecular Formula | C22H18N4O4S2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 4-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]-N-(4-nitrophenyl)butanamide |
| SMILES | O=C(CCCn1c(O)c(/C=C2\C=Nc3ccccc32)sc1=S)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H18N4O4S2/c27-20(24-15-7-9-16(10-8-15)26(29)30)6-3-11-25-21(28)19(32-22(25)31)12-14-13-23-18-5-2-1-4-17(14)18/h1-2,4-5,7-10,12-13,28H,3,6,11H2,(H,24,27)/b14-12+ |
| InChIKey | RNKPJTPGJXOQNP-WYMLVPIESA-N |
| XLogP | 5.57 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|