C21H16ClN3O2S2 — CID 135732676
N-(4-chlorophenyl)-3-[4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]propanamide (PubChem CID 135732676) has the molecular formula C21H16ClN3O2S2 and a molecular weight of 441.97 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-[4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]propanamide.
| Compound Name | N-(4-chlorophenyl)-3-[4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]propanamide |
|---|---|
| PubChem CID | 135732676 |
| Molecular Formula | C21H16ClN3O2S2 |
| Molecular Weight | 441.97 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | N-(4-chlorophenyl)-3-[4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]propanamide |
| SMILES | O=C(CCn1c(O)c(/C=C2/C=Nc3ccccc32)sc1=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16ClN3O2S2/c22-14-5-7-15(8-6-14)24-19(26)9-10-25-20(27)18(29-21(25)28)11-13-12-23-17-4-2-1-3-16(13)17/h1-8,11-12,27H,9-10H2,(H,24,26)/b13-11- |
| InChIKey | XSPJHOUVXMOBET-QBFSEMIESA-N |
| XLogP | 5.92 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.97 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|