C25H23N3O4S2 — CID 135718221
ethyl 4-[4-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanoylamino]benzoate (PubChem CID 135718221) has the molecular formula C25H23N3O4S2 and a molecular weight of 493.61 g/mol. Its IUPAC name is ethyl 4-[4-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanoylamino]benzoate.
| Compound Name | ethyl 4-[4-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanoylamino]benzoate |
|---|---|
| PubChem CID | 135718221 |
| Molecular Formula | C25H23N3O4S2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | ethyl 4-[4-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CCCn2c(O)c(/C=C3\C=Nc4ccccc43)sc2=S)cc1 |
| InChI | InChI=1S/C25H23N3O4S2/c1-2-32-24(31)16-9-11-18(12-10-16)27-22(29)8-5-13-28-23(30)21(34-25(28)33)14-17-15-26-20-7-4-3-6-19(17)20/h3-4,6-7,9-12,14-15,30H,2,5,8,13H2,1H3,(H,27,29)/b17-14+ |
| InChIKey | QTUKCLGOYQBMSM-SAPNQHFASA-N |
| XLogP | 5.84 |
| TPSA | 92.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|