C24H21N3O4S2 — CID 135718265
ethyl 4-[2-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]propanoylamino]benzoate (PubChem CID 135718265) has the molecular formula C24H21N3O4S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is ethyl 4-[2-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]propanoylamino]benzoate.
| Compound Name | ethyl 4-[2-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]propanoylamino]benzoate |
|---|---|
| PubChem CID | 135718265 |
| Molecular Formula | C24H21N3O4S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | ethyl 4-[2-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]propanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(C)n2c(O)c(/C=C3\C=Nc4ccccc43)sc2=S)cc1 |
| InChI | InChI=1S/C24H21N3O4S2/c1-3-31-23(30)15-8-10-17(11-9-15)26-21(28)14(2)27-22(29)20(33-24(27)32)12-16-13-25-19-7-5-4-6-18(16)19/h4-14,29H,3H2,1-2H3,(H,26,28)/b16-12+ |
| InChIKey | KUVWRODYMRXTHJ-FOWTUZBSSA-N |
| XLogP | 5.62 |
| TPSA | 92.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|