C21H18N4O4S3 — CID 135732685
3-[4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]-N-(4-sulfamoylphenyl)propanamide (PubChem CID 135732685) has the molecular formula C21H18N4O4S3 and a molecular weight of 486.60 g/mol. Its IUPAC name is 3-[4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 3-[4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 135732685 |
| Molecular Formula | C21H18N4O4S3 |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | 3-[4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]-N-(4-sulfamoylphenyl)propanamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CCn2c(O)c(/C=C3/C=Nc4ccccc43)sc2=S)cc1 |
| InChI | InChI=1S/C21H18N4O4S3/c22-32(28,29)15-7-5-14(6-8-15)24-19(26)9-10-25-20(27)18(31-21(25)30)11-13-12-23-17-4-2-1-3-16(13)17/h1-8,11-12,27H,9-10H2,(H,24,26)(H2,22,28,29)/b13-11- |
| InChIKey | AVHGENDXBLGONO-QBFSEMIESA-N |
| XLogP | 3.92 |
| TPSA | 126.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|