C19H15N3O3S3 — CID 2013825
N-[4-hydroxy-5-(indol-3-ylidenemethyl)-2-sulfanylidene-1,3-thiazol-3-yl]-4-methylbenzenesulfonamide (PubChem CID 2013825) has the molecular formula C19H15N3O3S3 and a molecular weight of 429.55 g/mol. Its IUPAC name is N-[4-hydroxy-5-(indol-3-ylidenemethyl)-2-sulfanylidene-1,3-thiazol-3-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4-hydroxy-5-(indol-3-ylidenemethyl)-2-sulfanylidene-1,3-thiazol-3-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 2013825 |
| Molecular Formula | C19H15N3O3S3 |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | N-[4-hydroxy-5-(indol-3-ylidenemethyl)-2-sulfanylidene-1,3-thiazol-3-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nn2c(O)c(C=C3C=Nc4ccccc43)sc2=S)cc1 |
| InChI | InChI=1S/C19H15N3O3S3/c1-12-6-8-14(9-7-12)28(24,25)21-22-18(23)17(27-19(22)26)10-13-11-20-16-5-3-2-4-15(13)16/h2-11,21,23H,1H3 |
| InChIKey | WIICXUJNRKZMAG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 83.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|