C21H16N2O3S2 — CID 137266478
ethyl 3-[4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]benzoate (PubChem CID 137266478) has the molecular formula C21H16N2O3S2 and a molecular weight of 408.50 g/mol. Its IUPAC name is ethyl 3-[4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]benzoate.
| Compound Name | ethyl 3-[4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]benzoate |
|---|---|
| PubChem CID | 137266478 |
| Molecular Formula | C21H16N2O3S2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | ethyl 3-[4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-n2c(O)c(/C=C3/C=Nc4ccccc43)sc2=S)c1 |
| InChI | InChI=1S/C21H16N2O3S2/c1-2-26-20(25)13-6-5-7-15(10-13)23-19(24)18(28-21(23)27)11-14-12-22-17-9-4-3-8-16(14)17/h3-12,24H,2H2,1H3/b14-11- |
| InChIKey | YMOZJAPTWMPXAL-KAMYIIQDSA-N |
| XLogP | 5.41 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|