C15H11N2O3S2- — CID 135577590
(2R)-2-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]propanoate (PubChem CID 135577590) has the molecular formula C15H11N2O3S2- and a molecular weight of 331.40 g/mol. Its IUPAC name is (2R)-2-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]propanoate.
| Compound Name | (2R)-2-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]propanoate |
|---|---|
| PubChem CID | 135577590 |
| Molecular Formula | C15H11N2O3S2- |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | (2R)-2-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]propanoate |
| SMILES | C[C@H](C(=O)[O-])n1c(O)c(/C=C2\C=Nc3ccccc32)sc1=S |
| InChI | InChI=1S/C15H12N2O3S2/c1-8(14(19)20)17-13(18)12(22-15(17)21)6-9-7-16-11-5-3-2-4-10(9)11/h2-8,18H,1H3,(H,19,20)/p-1/b9-6+/t8-/m1/s1 |
| InChIKey | IPQXXGHQBFWJLV-GTUWVTDSSA-M |
| XLogP | 2.55 |
| TPSA | 77.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|