C21H23N3O4S2 — CID 135718271
6-[2-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]propanoylamino]hexanoic acid (PubChem CID 135718271) has the molecular formula C21H23N3O4S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 6-[2-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]propanoylamino]hexanoic acid.
| Compound Name | 6-[2-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 135718271 |
| Molecular Formula | C21H23N3O4S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 6-[2-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]propanoylamino]hexanoic acid |
| SMILES | CC(C(=O)NCCCCCC(=O)O)n1c(O)c(/C=C2\C=Nc3ccccc32)sc1=S |
| InChI | InChI=1S/C21H23N3O4S2/c1-13(19(27)22-10-6-2-3-9-18(25)26)24-20(28)17(30-21(24)29)11-14-12-23-16-8-5-4-7-15(14)16/h4-5,7-8,11-13,28H,2-3,6,9-10H2,1H3,(H,22,27)(H,25,26)/b14-11+ |
| InChIKey | YONRSBDBTBHUQU-SDNWHVSQSA-N |
| XLogP | 4.56 |
| TPSA | 103.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|