C20H21N3O5S — CID 137262310
6-[[2-[4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-2-oxo-1,3-thiazol-3-yl]acetyl]amino]hexanoic acid (PubChem CID 137262310) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is 6-[[2-[4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-2-oxo-1,3-thiazol-3-yl]acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-[4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-2-oxo-1,3-thiazol-3-yl]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 137262310 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 6-[[2-[4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-2-oxo-1,3-thiazol-3-yl]acetyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)Cn1c(O)c(/C=C2/C=Nc3ccccc32)sc1=O |
| InChI | InChI=1S/C20H21N3O5S/c24-17(21-9-5-1-2-8-18(25)26)12-23-19(27)16(29-20(23)28)10-13-11-22-15-7-4-3-6-14(13)15/h3-4,6-7,10-11,27H,1-2,5,8-9,12H2,(H,21,24)(H,25,26)/b13-10- |
| InChIKey | DQNKVRLWISGTKD-RAXLEYEMSA-N |
| XLogP | 2.63 |
| TPSA | 120.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|