C22H25N3O4S2 — CID 135757156
4-[6-[4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]hexanoylamino]butanoic acid (PubChem CID 135757156) has the molecular formula C22H25N3O4S2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 4-[6-[4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]hexanoylamino]butanoic acid.
| Compound Name | 4-[6-[4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]hexanoylamino]butanoic acid |
|---|---|
| PubChem CID | 135757156 |
| Molecular Formula | C22H25N3O4S2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 4-[6-[4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]hexanoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)CCCCCn1c(O)c(/C=C2/C=Nc3ccccc32)sc1=S |
| InChI | InChI=1S/C22H25N3O4S2/c26-19(23-11-6-10-20(27)28)9-2-1-5-12-25-21(29)18(31-22(25)30)13-15-14-24-17-8-4-3-7-16(15)17/h3-4,7-8,13-14,29H,1-2,5-6,9-12H2,(H,23,26)(H,27,28)/b15-13- |
| InChIKey | LALRTUYBUFSMIX-SQFISAMPSA-N |
| XLogP | 4.78 |
| TPSA | 103.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|