C18H17N2O3S2- — CID 5157201
2-[4-hydroxy-5-(indol-3-ylidenemethyl)-2-sulfanylidene-1,3-thiazol-3-yl]-4-methylpentanoate (PubChem CID 5157201) has the molecular formula C18H17N2O3S2- and a molecular weight of 373.48 g/mol. Its IUPAC name is 2-[4-hydroxy-5-(indol-3-ylidenemethyl)-2-sulfanylidene-1,3-thiazol-3-yl]-4-methylpentanoate.
| Compound Name | 2-[4-hydroxy-5-(indol-3-ylidenemethyl)-2-sulfanylidene-1,3-thiazol-3-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 5157201 |
| Molecular Formula | C18H17N2O3S2- |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-[4-hydroxy-5-(indol-3-ylidenemethyl)-2-sulfanylidene-1,3-thiazol-3-yl]-4-methylpentanoate |
| SMILES | CC(C)CC(C(=O)[O-])n1c(O)c(C=C2C=Nc3ccccc32)sc1=S |
| InChI | InChI=1S/C18H18N2O3S2/c1-10(2)7-14(17(22)23)20-16(21)15(25-18(20)24)8-11-9-19-13-6-4-3-5-12(11)13/h3-6,8-10,14,21H,7H2,1-2H3,(H,22,23)/p-1 |
| InChIKey | AELXUMYXXQTONG-UHFFFAOYSA-M |
| XLogP | 3.58 |
| TPSA | 77.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|