C16H13N2O3S2- — CID 135830604
(2S)-2-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanoate (PubChem CID 135830604) has the molecular formula C16H13N2O3S2- and a molecular weight of 345.43 g/mol. Its IUPAC name is (2S)-2-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanoate.
| Compound Name | (2S)-2-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanoate |
|---|---|
| PubChem CID | 135830604 |
| Molecular Formula | C16H13N2O3S2- |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | (2S)-2-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanoate |
| SMILES | CC[C@@H](C(=O)[O-])n1c(O)c(/C=C2\C=Nc3ccccc32)sc1=S |
| InChI | InChI=1S/C16H14N2O3S2/c1-2-12(15(20)21)18-14(19)13(23-16(18)22)7-9-8-17-11-6-4-3-5-10(9)11/h3-8,12,19H,2H2,1H3,(H,20,21)/p-1/b9-7+/t12-/m0/s1 |
| InChIKey | GDTVCAJGYSLJPH-CRALRDPISA-M |
| XLogP | 2.94 |
| TPSA | 77.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|