C18H16N2O5S2 — CID 135925046
4-[4-hydroxy-5-[(2-methoxycarbonylindol-3-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanoic acid (PubChem CID 135925046) has the molecular formula C18H16N2O5S2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 4-[4-hydroxy-5-[(2-methoxycarbonylindol-3-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanoic acid.
| Compound Name | 4-[4-hydroxy-5-[(2-methoxycarbonylindol-3-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 135925046 |
| Molecular Formula | C18H16N2O5S2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 4-[4-hydroxy-5-[(2-methoxycarbonylindol-3-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanoic acid |
| SMILES | COC(=O)C1=Nc2ccccc2C1=Cc1sc(=S)n(CCCC(=O)O)c1O |
| InChI | InChI=1S/C18H16N2O5S2/c1-25-17(24)15-11(10-5-2-3-6-12(10)19-15)9-13-16(23)20(18(26)27-13)8-4-7-14(21)22/h2-3,5-6,9,23H,4,7-8H2,1H3,(H,21,22) |
| InChIKey | XBPVKYADSGVXLK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 101.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|