C21H14N2O5S2 — CID 135653298
4-[4-hydroxy-5-[(E)-(2-methoxycarbonylindol-3-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]benzoic acid (PubChem CID 135653298) has the molecular formula C21H14N2O5S2 and a molecular weight of 438.49 g/mol. Its IUPAC name is 4-[4-hydroxy-5-[(E)-(2-methoxycarbonylindol-3-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]benzoic acid.
| Compound Name | 4-[4-hydroxy-5-[(E)-(2-methoxycarbonylindol-3-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 135653298 |
| Molecular Formula | C21H14N2O5S2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 4-[4-hydroxy-5-[(E)-(2-methoxycarbonylindol-3-ylidene)methyl]-2-sulfanylidene-1,3-thiazol-3-yl]benzoic acid |
| SMILES | COC(=O)C1=Nc2ccccc2/C1=C\c1sc(=S)n(-c2ccc(C(=O)O)cc2)c1O |
| InChI | InChI=1S/C21H14N2O5S2/c1-28-20(27)17-14(13-4-2-3-5-15(13)22-17)10-16-18(24)23(21(29)30-16)12-8-6-11(7-9-12)19(25)26/h2-10,24H,1H3,(H,25,26)/b14-10+ |
| InChIKey | WZPJBGDVUDPUPS-GXDHUFHOSA-N |
| XLogP | 4.47 |
| TPSA | 101.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|