C13H11NO3S2 — CID 91402639
methyl 4-(5-ethenyl-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)benzoate (PubChem CID 91402639) has the molecular formula C13H11NO3S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is methyl 4-(5-ethenyl-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)benzoate.
| Compound Name | methyl 4-(5-ethenyl-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)benzoate |
|---|---|
| PubChem CID | 91402639 |
| Molecular Formula | C13H11NO3S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | methyl 4-(5-ethenyl-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)benzoate |
| SMILES | C=Cc1sc(=S)n(-c2ccc(C(=O)OC)cc2)c1O |
| InChI | InChI=1S/C13H11NO3S2/c1-3-10-11(15)14(13(18)19-10)9-6-4-8(5-7-9)12(16)17-2/h3-7,15H,1H2,2H3 |
| InChIKey | HXTUIQVWCIFGDN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|