C15H15NO3S2 — CID 91362151
4-[4-hydroxy-5-(2-phenylethenyl)-2-sulfanylidene-1,3-thiazol-3-yl]butanoic acid (PubChem CID 91362151) has the molecular formula C15H15NO3S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-[4-hydroxy-5-(2-phenylethenyl)-2-sulfanylidene-1,3-thiazol-3-yl]butanoic acid.
| Compound Name | 4-[4-hydroxy-5-(2-phenylethenyl)-2-sulfanylidene-1,3-thiazol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 91362151 |
| Molecular Formula | C15H15NO3S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 4-[4-hydroxy-5-(2-phenylethenyl)-2-sulfanylidene-1,3-thiazol-3-yl]butanoic acid |
| SMILES | O=C(O)CCCn1c(O)c(C=Cc2ccccc2)sc1=S |
| InChI | InChI=1S/C15H15NO3S2/c17-13(18)7-4-10-16-14(19)12(21-15(16)20)9-8-11-5-2-1-3-6-11/h1-3,5-6,8-9,19H,4,7,10H2,(H,17,18) |
| InChIKey | OPRSPMFEGIROOO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|