C15H15N3O3S2 — CID 91142352
4-[4-hydroxy-5-[2-(2-phenylhydrazinyl)ethynyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanoic acid (PubChem CID 91142352) has the molecular formula C15H15N3O3S2 and a molecular weight of 349.44 g/mol. Its IUPAC name is 4-[4-hydroxy-5-[2-(2-phenylhydrazinyl)ethynyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanoic acid.
| Compound Name | 4-[4-hydroxy-5-[2-(2-phenylhydrazinyl)ethynyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 91142352 |
| Molecular Formula | C15H15N3O3S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 4-[4-hydroxy-5-[2-(2-phenylhydrazinyl)ethynyl]-2-sulfanylidene-1,3-thiazol-3-yl]butanoic acid |
| SMILES | O=C(O)CCCn1c(O)c(C#CNNc2ccccc2)sc1=S |
| InChI | InChI=1S/C15H15N3O3S2/c19-13(20)7-4-10-18-14(21)12(23-15(18)22)8-9-16-17-11-5-2-1-3-6-11/h1-3,5-6,16-17,21H,4,7,10H2,(H,19,20) |
| InChIKey | CLFJHYVGYVMUSD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|