C10H11NO3S2 — CID 91249902
4-(4-hydroxy-5-propa-1,2-dienyl-2-sulfanylidene-1,3-thiazol-3-yl)butanoic acid (PubChem CID 91249902) has the molecular formula C10H11NO3S2 and a molecular weight of 257.34 g/mol. Its IUPAC name is 4-(4-hydroxy-5-propa-1,2-dienyl-2-sulfanylidene-1,3-thiazol-3-yl)butanoic acid.
| Compound Name | 4-(4-hydroxy-5-propa-1,2-dienyl-2-sulfanylidene-1,3-thiazol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 91249902 |
| Molecular Formula | C10H11NO3S2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 4-(4-hydroxy-5-propa-1,2-dienyl-2-sulfanylidene-1,3-thiazol-3-yl)butanoic acid |
| SMILES | C=C=Cc1sc(=S)n(CCCC(=O)O)c1O |
| InChI | InChI=1S/C10H11NO3S2/c1-2-4-7-9(14)11(10(15)16-7)6-3-5-8(12)13/h4,14H,1,3,5-6H2,(H,12,13) |
| InChIKey | PNHYBJSBVZIQJQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|