C20H18N2O2S2 — CID 23960254
4-(4-oxo-6-phenyl-2-sulfanylidene-1,3-thiazin-3-yl)-N-phenylbutanamide (PubChem CID 23960254) has the molecular formula C20H18N2O2S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 4-(4-oxo-6-phenyl-2-sulfanylidene-1,3-thiazin-3-yl)-N-phenylbutanamide.
| Compound Name | 4-(4-oxo-6-phenyl-2-sulfanylidene-1,3-thiazin-3-yl)-N-phenylbutanamide |
|---|---|
| PubChem CID | 23960254 |
| Molecular Formula | C20H18N2O2S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 4-(4-oxo-6-phenyl-2-sulfanylidene-1,3-thiazin-3-yl)-N-phenylbutanamide |
| SMILES | O=C(CCCn1c(=O)cc(-c2ccccc2)sc1=S)Nc1ccccc1 |
| InChI | InChI=1S/C20H18N2O2S2/c23-18(21-16-10-5-2-6-11-16)12-7-13-22-19(24)14-17(26-20(22)25)15-8-3-1-4-9-15/h1-6,8-11,14H,7,12-13H2,(H,21,23) |
| InChIKey | OYOYFFAJOGGDEI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ester_C(2)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|