C23H24N2O6S2 — CID 23740621
N-(4-methoxyphenyl)-3-[4-oxo-2-sulfanylidene-6-(3,4,5-trimethoxyphenyl)-1,3-thiazin-3-yl]propanamide (PubChem CID 23740621) has the molecular formula C23H24N2O6S2 and a molecular weight of 488.59 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-3-[4-oxo-2-sulfanylidene-6-(3,4,5-trimethoxyphenyl)-1,3-thiazin-3-yl]propanamide.
| Compound Name | N-(4-methoxyphenyl)-3-[4-oxo-2-sulfanylidene-6-(3,4,5-trimethoxyphenyl)-1,3-thiazin-3-yl]propanamide |
|---|---|
| PubChem CID | 23740621 |
| Molecular Formula | C23H24N2O6S2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | N-(4-methoxyphenyl)-3-[4-oxo-2-sulfanylidene-6-(3,4,5-trimethoxyphenyl)-1,3-thiazin-3-yl]propanamide |
| SMILES | COc1ccc(NC(=O)CCn2c(=O)cc(-c3cc(OC)c(OC)c(OC)c3)sc2=S)cc1 |
| InChI | InChI=1S/C23H24N2O6S2/c1-28-16-7-5-15(6-8-16)24-20(26)9-10-25-21(27)13-19(33-23(25)32)14-11-17(29-2)22(31-4)18(12-14)30-3/h5-8,11-13H,9-10H2,1-4H3,(H,24,26) |
| InChIKey | UUCRQTYDSYSSDF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_ester_C(2)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|