C17H22N2O2S2 — CID 17034152
6-(5-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-phenylhexanamide (PubChem CID 17034152) has the molecular formula C17H22N2O2S2 and a molecular weight of 350.51 g/mol. Its IUPAC name is 6-(5-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-phenylhexanamide.
| Compound Name | 6-(5-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-phenylhexanamide |
|---|---|
| PubChem CID | 17034152 |
| Molecular Formula | C17H22N2O2S2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 6-(5-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-phenylhexanamide |
| SMILES | CCC1SC(=S)N(CCCCCC(=O)Nc2ccccc2)C1=O |
| InChI | InChI=1S/C17H22N2O2S2/c1-2-14-16(21)19(17(22)23-14)12-8-4-7-11-15(20)18-13-9-5-3-6-10-13/h3,5-6,9-10,14H,2,4,7-8,11-12H2,1H3,(H,18,20) |
| InChIKey | ZGYRADJTKYIGGB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|